C24H32N4O4S — CID 2349676
1-[[3-(diethylsulfamoyl)benzoyl]amino]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea (PubChem CID 2349676) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is 1-[[3-(diethylsulfamoyl)benzoyl]amino]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea.
| Compound Name | 1-[[3-(diethylsulfamoyl)benzoyl]amino]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 2349676 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 1-[[3-(diethylsulfamoyl)benzoyl]amino]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)NNC(=O)c2cccc(S(=O)(=O)N(CC)CC)c2)c1 |
| InChI | InChI=1S/C24H32N4O4S/c1-7-28(8-2)33(31,32)21-14-10-12-19(16-21)22(29)26-27-23(30)25-24(5,6)20-13-9-11-18(15-20)17(3)4/h9-16H,3,7-8H2,1-2,4-6H3,(H,26,29)(H2,25,27,30) |
| InChIKey | ORGZKRDQOLKWHM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|