C18H26N2O3 — CID 170063561
benzyl (2S)-3-methyl-2-(2-oxo-1,5-diazocan-1-yl)butanoate (PubChem CID 170063561) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is benzyl (2S)-3-methyl-2-(2-oxo-1,5-diazocan-1-yl)butanoate.
| Compound Name | benzyl (2S)-3-methyl-2-(2-oxo-1,5-diazocan-1-yl)butanoate |
|---|---|
| PubChem CID | 170063561 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | benzyl (2S)-3-methyl-2-(2-oxo-1,5-diazocan-1-yl)butanoate |
| SMILES | CC(C)[C@@H](C(=O)OCc1ccccc1)N1CCCNCCC1=O |
| InChI | InChI=1S/C18H26N2O3/c1-14(2)17(20-12-6-10-19-11-9-16(20)21)18(22)23-13-15-7-4-3-5-8-15/h3-5,7-8,14,17,19H,6,9-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | GUTZUCBBYLXFNC-KRWDZBQOSA-N |
| XLogP | 1.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |