C21H24N2O — CID 170063798
(Z,2E)-2-ethylidene-N-[4-[(N-methylanilino)methyl]phenyl]pent-3-enamide (PubChem CID 170063798) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-N-[4-[(N-methylanilino)methyl]phenyl]pent-3-enamide.
| Compound Name | (Z,2E)-2-ethylidene-N-[4-[(N-methylanilino)methyl]phenyl]pent-3-enamide |
|---|---|
| PubChem CID | 170063798 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (Z,2E)-2-ethylidene-N-[4-[(N-methylanilino)methyl]phenyl]pent-3-enamide |
| SMILES | C/C=C\C(=C/C)C(=O)Nc1ccc(CN(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O/c1-4-9-18(5-2)21(24)22-19-14-12-17(13-15-19)16-23(3)20-10-7-6-8-11-20/h4-15H,16H2,1-3H3,(H,22,24)/b9-4-,18-5+ |
| InChIKey | KBXDTTSHOBRQNY-HHUKGDAASA-N |
| XLogP | 4.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|