C29H38N4O2 — CID 17006484
N-[[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]methyl]-2-ethylbutanamide (PubChem CID 17006484) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-[[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]methyl]-2-ethylbutanamide.
| Compound Name | N-[[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]methyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 17006484 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | N-[[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]methyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCc1nc2ccccc2n1CC(=O)N(Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C29H38N4O2/c1-3-23(4-2)29(35)30-19-27-31-25-17-11-12-18-26(25)33(27)21-28(34)32(24-15-9-6-10-16-24)20-22-13-7-5-8-14-22/h5,7-8,11-14,17-18,23-24H,3-4,6,9-10,15-16,19-21H2,1-2H3,(H,30,35) |
| InChIKey | OQOZTYGTFMRKNP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |