C52H39N3OS — CID 170065907
N'-[2-[(8-cyclohexa-1,3-dien-1-yl-6-phenyldibenzofuran-1-yl)methyl]-1-benzothiophen-3-yl]-9-phenyl-4b,8a-dihydrocarbazole-2-carboximidamide (PubChem CID 170065907) has the molecular formula C52H39N3OS and a molecular weight of 753.97 g/mol. Its IUPAC name is N'-[2-[(8-cyclohexa-1,3-dien-1-yl-6-phenyldibenzofuran-1-yl)methyl]-1-benzothiophen-3-yl]-9-phenyl-4b,8a-dihydrocarbazole-2-carboximidamide.
| Compound Name | N'-[2-[(8-cyclohexa-1,3-dien-1-yl-6-phenyldibenzofuran-1-yl)methyl]-1-benzothiophen-3-yl]-9-phenyl-4b,8a-dihydrocarbazole-2-carboximidamide |
|---|---|
| PubChem CID | 170065907 |
| Molecular Formula | C52H39N3OS |
| Molecular Weight | 753.97 g/mol |
| Exact Mass | 753.28 |
| IUPAC Name | N'-[2-[(8-cyclohexa-1,3-dien-1-yl-6-phenyldibenzofuran-1-yl)methyl]-1-benzothiophen-3-yl]-9-phenyl-4b,8a-dihydrocarbazole-2-carboximidamide |
| SMILES | N/C(=N\c1c(Cc2cccc3oc4c(-c5ccccc5)cc(C5=CC=CCC5)cc4c23)sc2ccccc12)c1ccc2c(c1)N(c1ccccc1)C1C=CC=CC21 |
| InChI | InChI=1S/C52H39N3OS/c53-52(36-27-28-40-39-22-10-12-24-44(39)55(45(40)31-36)38-20-8-3-9-21-38)54-50-41-23-11-13-26-47(41)57-48(50)32-35-19-14-25-46-49(35)43-30-37(33-15-4-1-5-16-33)29-42(51(43)56-46)34-17-6-2-7-18-34/h1-4,6-15,17-31,39,44H,5,16,32H2,(H2,53,54) |
| InChIKey | CLMKJZHGJFCJNJ-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 54.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.97 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|