C21H19N7O4 — CID 170066721
4-methyl-N-[5-[[(4-nitrophenyl)methylamino]methyl]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]benzamide (PubChem CID 170066721) has the molecular formula C21H19N7O4 and a molecular weight of 433.43 g/mol. Its IUPAC name is 4-methyl-N-[5-[[(4-nitrophenyl)methylamino]methyl]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]benzamide.
| Compound Name | 4-methyl-N-[5-[[(4-nitrophenyl)methylamino]methyl]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 170066721 |
| Molecular Formula | C21H19N7O4 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 4-methyl-N-[5-[[(4-nitrophenyl)methylamino]methyl]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc3nc(CNCc4ccc([N+](=O)[O-])cc4)cc(=O)n3[nH]2)cc1 |
| InChI | InChI=1S/C21H19N7O4/c1-13-2-6-15(7-3-13)19(30)24-20-25-21-23-16(10-18(29)27(21)26-20)12-22-11-14-4-8-17(9-5-14)28(31)32/h2-10,22H,11-12H2,1H3,(H2,23,24,25,26,30) |
| InChIKey | IYIZVTMMHGXCDA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|