C24H20ClN3O2 — CID 17007398
N-[[1-[2-(4-chlorophenyl)-2-oxoethyl]benzimidazol-2-yl]methyl]-3-methylbenzamide (PubChem CID 17007398) has the molecular formula C24H20ClN3O2 and a molecular weight of 417.90 g/mol. Its IUPAC name is N-[[1-[2-(4-chlorophenyl)-2-oxoethyl]benzimidazol-2-yl]methyl]-3-methylbenzamide.
| Compound Name | N-[[1-[2-(4-chlorophenyl)-2-oxoethyl]benzimidazol-2-yl]methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 17007398 |
| Molecular Formula | C24H20ClN3O2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-[[1-[2-(4-chlorophenyl)-2-oxoethyl]benzimidazol-2-yl]methyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCc2nc3ccccc3n2CC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H20ClN3O2/c1-16-5-4-6-18(13-16)24(30)26-14-23-27-20-7-2-3-8-21(20)28(23)15-22(29)17-9-11-19(25)12-10-17/h2-13H,14-15H2,1H3,(H,26,30) |
| InChIKey | DDKHBMWCDZERRW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |