C21H23ClN4O2 — CID 17029539
N-[[1-[2-(butan-2-ylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-4-chlorobenzamide (PubChem CID 17029539) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is N-[[1-[2-(butan-2-ylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-4-chlorobenzamide.
| Compound Name | N-[[1-[2-(butan-2-ylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 17029539 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[[1-[2-(butan-2-ylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-4-chlorobenzamide |
| SMILES | CCC(C)NC(=O)Cn1c(CNC(=O)c2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C21H23ClN4O2/c1-3-14(2)24-20(27)13-26-18-7-5-4-6-17(18)25-19(26)12-23-21(28)15-8-10-16(22)11-9-15/h4-11,14H,3,12-13H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | CYCNXIBEABEEBJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |