C20H21ClN4O2 — CID 17029540
4-chloro-N-[[1-[2-oxo-2-(propan-2-ylamino)ethyl]benzimidazol-2-yl]methyl]benzamide (PubChem CID 17029540) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 4-chloro-N-[[1-[2-oxo-2-(propan-2-ylamino)ethyl]benzimidazol-2-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[1-[2-oxo-2-(propan-2-ylamino)ethyl]benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 17029540 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-chloro-N-[[1-[2-oxo-2-(propan-2-ylamino)ethyl]benzimidazol-2-yl]methyl]benzamide |
| SMILES | CC(C)NC(=O)Cn1c(CNC(=O)c2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C20H21ClN4O2/c1-13(2)23-19(26)12-25-17-6-4-3-5-16(17)24-18(25)11-22-20(27)14-7-9-15(21)10-8-14/h3-10,13H,11-12H2,1-2H3,(H,22,27)(H,23,26) |
| InChIKey | OMGRXAVGTBNVMS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |