C30H37N — CID 170075562
4-tert-butyl-4-[4-[3-(4-propan-2-ylphenyl)phenyl]phenyl]piperidine (PubChem CID 170075562) has the molecular formula C30H37N and a molecular weight of 411.63 g/mol. Its IUPAC name is 4-tert-butyl-4-[4-[3-(4-propan-2-ylphenyl)phenyl]phenyl]piperidine.
| Compound Name | 4-tert-butyl-4-[4-[3-(4-propan-2-ylphenyl)phenyl]phenyl]piperidine |
|---|---|
| PubChem CID | 170075562 |
| Molecular Formula | C30H37N |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | 4-tert-butyl-4-[4-[3-(4-propan-2-ylphenyl)phenyl]phenyl]piperidine |
| SMILES | CC(C)c1ccc(-c2cccc(-c3ccc(C4(C(C)(C)C)CCNCC4)cc3)c2)cc1 |
| InChI | InChI=1S/C30H37N/c1-22(2)23-9-11-24(12-10-23)26-7-6-8-27(21-26)25-13-15-28(16-14-25)30(29(3,4)5)17-19-31-20-18-30/h6-16,21-22,31H,17-20H2,1-5H3 |
| InChIKey | YYHLOOQIHHICEP-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |