About 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane
8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 59692125) has the molecular formula C21H32O2
and a molecular weight of 316.49 g/mol. Its IUPAC name is 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 59692125 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | CC(C)c1cccc(C2(C(C)(C)C)CCC3(CC2)OCCO3)c1 |
| InChI | InChI=1S/C21H32O2/c1-16(2)17-7-6-8-18(15-17)20(19(3,4)5)9-11-21(12-10-20)22-13-14-23-21/h6-8,15-16H,9-14H2,1-5H3 |
| InChIKey | ADFDJJQMNUNIQA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane (CID 59692125) is 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane is CC(C)c1cccc(C2(C(C)(C)C)CCC3(CC2)OCCO3)c1.
What is the InChIKey of 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane?
The InChIKey is ADFDJJQMNUNIQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O2/c1-16(2)17-7-6-8-18(15-17)20(19(3,4)5)9-11-21(12-10-20)22-13-14-23-21/h6-8,15-16H,9-14H2,1-5H3.
What are the key properties of 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane?
8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane has a molecular weight of 316.49 g/mol, XLogP of 5.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-8-(3-propan-2-ylphenyl)-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 59692125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).