C13H12Cl2F2N3O2P — CID 170078616
2,5-dichloro-N-[4-(difluoromethoxy)-2-dimethylphosphanyloxyphenyl]pyrimidin-4-amine (PubChem CID 170078616) has the molecular formula C13H12Cl2F2N3O2P and a molecular weight of 382.13 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-(difluoromethoxy)-2-dimethylphosphanyloxyphenyl]pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-[4-(difluoromethoxy)-2-dimethylphosphanyloxyphenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170078616 |
| Molecular Formula | C13H12Cl2F2N3O2P |
| Molecular Weight | 382.13 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2,5-dichloro-N-[4-(difluoromethoxy)-2-dimethylphosphanyloxyphenyl]pyrimidin-4-amine |
| SMILES | CP(C)Oc1cc(OC(F)F)ccc1Nc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C13H12Cl2F2N3O2P/c1-23(2)22-10-5-7(21-13(16)17)3-4-9(10)19-11-8(14)6-18-12(15)20-11/h3-6,13H,1-2H3,(H,18,19,20) |
| InChIKey | DPKCHBLSXIJGNU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.13 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|