C13H17Cl2N3OP2S — CID 170078736
2,5-dichloro-N-(2-dimethylphosphanyloxy-4-methylsulfanylphenyl)pyrimidin-4-amine;phosphane (PubChem CID 170078736) has the molecular formula C13H17Cl2N3OP2S and a molecular weight of 396.22 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-dimethylphosphanyloxy-4-methylsulfanylphenyl)pyrimidin-4-amine;phosphane.
| Compound Name | 2,5-dichloro-N-(2-dimethylphosphanyloxy-4-methylsulfanylphenyl)pyrimidin-4-amine;phosphane |
|---|---|
| PubChem CID | 170078736 |
| Molecular Formula | C13H17Cl2N3OP2S |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 2,5-dichloro-N-(2-dimethylphosphanyloxy-4-methylsulfanylphenyl)pyrimidin-4-amine;phosphane |
| SMILES | CSc1ccc(Nc2nc(Cl)ncc2Cl)c(OP(C)C)c1.P |
| InChI | InChI=1S/C13H14Cl2N3OPS.H3P/c1-20(2)19-11-6-8(21-3)4-5-10(11)17-12-9(14)7-16-13(15)18-12;/h4-7H,1-3H3,(H,16,17,18);1H3 |
| InChIKey | MJWJTFAYULWUPL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|