C13H15Cl2N3O2P2 — CID 170078686
4-[(2,5-dichloropyrimidin-4-yl)amino]-3-dimethylphosphanyloxybenzaldehyde;phosphane (PubChem CID 170078686) has the molecular formula C13H15Cl2N3O2P2 and a molecular weight of 378.14 g/mol. Its IUPAC name is 4-[(2,5-dichloropyrimidin-4-yl)amino]-3-dimethylphosphanyloxybenzaldehyde;phosphane.
| Compound Name | 4-[(2,5-dichloropyrimidin-4-yl)amino]-3-dimethylphosphanyloxybenzaldehyde;phosphane |
|---|---|
| PubChem CID | 170078686 |
| Molecular Formula | C13H15Cl2N3O2P2 |
| Molecular Weight | 378.14 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 4-[(2,5-dichloropyrimidin-4-yl)amino]-3-dimethylphosphanyloxybenzaldehyde;phosphane |
| SMILES | CP(C)Oc1cc(C=O)ccc1Nc1nc(Cl)ncc1Cl.P |
| InChI | InChI=1S/C13H12Cl2N3O2P.H3P/c1-21(2)20-11-5-8(7-19)3-4-10(11)17-12-9(14)6-16-13(15)18-12;/h3-7H,1-2H3,(H,16,17,18);1H3 |
| InChIKey | SSHUVZGAUXXJTB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.14 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|