About 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine
6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 170078658) has the molecular formula C9H14N2
and a molecular weight of 150.23 g/mol. Its IUPAC name is 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
Analyze 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
The IUPAC name of 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (CID 170078658) is 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
What is the SMILES notation for 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
The canonical SMILES for 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine is CCC1CCc2ccnn2C1.
What is the InChIKey of 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
The InChIKey is QNPZNLYFMJNXPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-2-8-3-4-9-5-6-10-11(9)7-8/h5-6,8H,2-4,7H2,1H3.
What are the key properties of 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine has a molecular weight of 150.23 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine is sourced from PubChem (CID 170078658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).