C22H12Cl2N4 — CID 170078998
3-(4,6-dichloro-1,3,5-triazin-2-yl)-5-phenylcyclohepta[b]indole (PubChem CID 170078998) has the molecular formula C22H12Cl2N4 and a molecular weight of 403.27 g/mol. Its IUPAC name is 3-(4,6-dichloro-1,3,5-triazin-2-yl)-5-phenylcyclohepta[b]indole.
| Compound Name | 3-(4,6-dichloro-1,3,5-triazin-2-yl)-5-phenylcyclohepta[b]indole |
|---|---|
| PubChem CID | 170078998 |
| Molecular Formula | C22H12Cl2N4 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 3-(4,6-dichloro-1,3,5-triazin-2-yl)-5-phenylcyclohepta[b]indole |
| SMILES | Clc1nc(Cl)nc(-c2ccc3c4c(n(-c5ccccc5)c3c2)C=C=CC=C4)n1 |
| InChI | InChI=1S/C22H12Cl2N4/c23-21-25-20(26-22(24)27-21)14-11-12-17-16-9-5-2-6-10-18(16)28(19(17)13-14)15-7-3-1-4-8-15/h1-5,7-13H |
| InChIKey | JWCOBBSLKHHSMD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |