C12H14F3NO2 — CID 170080547
4-(methylamino)-3-[3-(trifluoromethoxy)phenyl]butanal (PubChem CID 170080547) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 4-(methylamino)-3-[3-(trifluoromethoxy)phenyl]butanal.
| Compound Name | 4-(methylamino)-3-[3-(trifluoromethoxy)phenyl]butanal |
|---|---|
| PubChem CID | 170080547 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-(methylamino)-3-[3-(trifluoromethoxy)phenyl]butanal |
| SMILES | CNCC(CC=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO2/c1-16-8-10(5-6-17)9-3-2-4-11(7-9)18-12(13,14)15/h2-4,6-7,10,16H,5,8H2,1H3 |
| InChIKey | ILHTZKLKGXWTDQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|