C17H22N2O2PS+ — CID 170081189
5,10-dioxo-2,10-di(propan-2-yl)-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium-1-amine (PubChem CID 170081189) has the molecular formula C17H22N2O2PS+ and a molecular weight of 349.42 g/mol. Its IUPAC name is 5,10-dioxo-2,10-di(propan-2-yl)-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium-1-amine.
| Compound Name | 5,10-dioxo-2,10-di(propan-2-yl)-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium-1-amine |
|---|---|
| PubChem CID | 170081189 |
| Molecular Formula | C17H22N2O2PS+ |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 5,10-dioxo-2,10-di(propan-2-yl)-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium-1-amine |
| SMILES | CC(C)c1ccc2c([n+]1N)P(=O)(C(C)C)c1ccccc1S2=O |
| InChI | InChI=1S/C17H22N2O2PS/c1-11(2)13-9-10-16-17(19(13)18)22(20,12(3)4)14-7-5-6-8-15(14)23(16)21/h5-12H,18H2,1-4H3/q+1 |
| InChIKey | JWLSZYJHALWACO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|