C10H12S — CID 170081340
2-[(2Z,4E)-hexa-2,4-dien-3-yl]thiophene (PubChem CID 170081340) has the molecular formula C10H12S and a molecular weight of 164.27 g/mol. Its IUPAC name is 2-[(2Z,4E)-hexa-2,4-dien-3-yl]thiophene.
| Compound Name | 2-[(2Z,4E)-hexa-2,4-dien-3-yl]thiophene |
|---|---|
| PubChem CID | 170081340 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-[(2Z,4E)-hexa-2,4-dien-3-yl]thiophene |
| SMILES | C/C=C(/C=C/C)c1cccs1 |
| InChI | InChI=1S/C10H12S/c1-3-6-9(4-2)10-7-5-8-11-10/h3-8H,1-2H3/b6-3+,9-4- |
| InChIKey | HLNXAKKBPNSSGC-OHUKKYLXSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|