C31H48O2 — CID 170082625
[(3S,8S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R,3E)-6-methylhepta-3,5-dien-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanoate (PubChem CID 170082625) has the molecular formula C31H48O2 and a molecular weight of 452.72 g/mol. Its IUPAC name is [(3S,8S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R,3E)-6-methylhepta-3,5-dien-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanoate.
| Compound Name | [(3S,8S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R,3E)-6-methylhepta-3,5-dien-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanoate |
|---|---|
| PubChem CID | 170082625 |
| Molecular Formula | C31H48O2 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | [(3S,8S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R,3E)-6-methylhepta-3,5-dien-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3C2CC[C@]2(C)[C@@H]([C@H](C)/C=C/C=C(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H48O2/c1-7-9-29(32)33-24-16-18-30(5)23(20-24)12-13-25-27-15-14-26(22(4)11-8-10-21(2)3)31(27,6)19-17-28(25)30/h8,10-12,22,24-28H,7,9,13-20H2,1-6H3/b11-8+/t22-,24+,25+,26-,27+,28?,30+,31-/m1/s1 |
| InChIKey | UMJHSYZEFICYLD-IMLLUJFWSA-N |
| XLogP | 8.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|