C30H46O2 — CID 170082031
[(3R,8S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R,3Z)-6-methylhepta-3,5-dien-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanoate (PubChem CID 170082031) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is [(3R,8S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R,3Z)-6-methylhepta-3,5-dien-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanoate.
| Compound Name | [(3R,8S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R,3Z)-6-methylhepta-3,5-dien-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanoate |
|---|---|
| PubChem CID | 170082031 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | [(3R,8S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R,3Z)-6-methylhepta-3,5-dien-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1CC[C@@]2(C)C(=CC[C@@H]3C2CC[C@]2(C)[C@@H]([C@H](C)/C=C\C=C(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H46O2/c1-7-28(31)32-23-15-17-29(5)22(19-23)11-12-24-26-14-13-25(21(4)10-8-9-20(2)3)30(26,6)18-16-27(24)29/h8-11,21,23-27H,7,12-19H2,1-6H3/b10-8-/t21-,23-,24+,25-,26+,27?,29+,30-/m1/s1 |
| InChIKey | NUBLIXLVGWZSCN-FULFIPEDSA-N |
| XLogP | 8.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|