C25H31N3O3 — CID 17008409
N-[[1-(2-cyclohexylethyl)benzimidazol-2-yl]methyl]-3,4-dimethoxybenzamide (PubChem CID 17008409) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[[1-(2-cyclohexylethyl)benzimidazol-2-yl]methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[1-(2-cyclohexylethyl)benzimidazol-2-yl]methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17008409 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-[[1-(2-cyclohexylethyl)benzimidazol-2-yl]methyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2nc3ccccc3n2CCC2CCCCC2)cc1OC |
| InChI | InChI=1S/C25H31N3O3/c1-30-22-13-12-19(16-23(22)31-2)25(29)26-17-24-27-20-10-6-7-11-21(20)28(24)15-14-18-8-4-3-5-9-18/h6-7,10-13,16,18H,3-5,8-9,14-15,17H2,1-2H3,(H,26,29) |
| InChIKey | WVGUMALJNZHUHI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |