C27H35N3O4 — CID 17009816
N-[1-[1-(2-cyclohexylethyl)benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 17009816) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is N-[1-[1-(2-cyclohexylethyl)benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-[1-(2-cyclohexylethyl)benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 17009816 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | N-[1-[1-(2-cyclohexylethyl)benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(C)c2nc3ccccc3n2CCC2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C27H35N3O4/c1-18(28-27(31)20-16-23(32-2)25(34-4)24(17-20)33-3)26-29-21-12-8-9-13-22(21)30(26)15-14-19-10-6-5-7-11-19/h8-9,12-13,16-19H,5-7,10-11,14-15H2,1-4H3,(H,28,31) |
| InChIKey | DRPNCGQWDDDUPS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |