C28H37N3O4 — CID 16983969
N-[3-[1-(2-cyclohexylethyl)benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide (PubChem CID 16983969) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-[3-[1-(2-cyclohexylethyl)benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[1-(2-cyclohexylethyl)benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16983969 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | N-[3-[1-(2-cyclohexylethyl)benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCc2nc3ccccc3n2CCC2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C28H37N3O4/c1-33-24-18-21(19-25(34-2)27(24)35-3)28(32)29-16-9-14-26-30-22-12-7-8-13-23(22)31(26)17-15-20-10-5-4-6-11-20/h7-8,12-13,18-20H,4-6,9-11,14-17H2,1-3H3,(H,29,32) |
| InChIKey | KVPXNMRHVPJFAU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|