C29H38N4O5 — CID 16991194
3,4,5-trimethoxy-N-[5-[1-(2-oxo-2-piperidin-1-ylethyl)benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16991194) has the molecular formula C29H38N4O5 and a molecular weight of 522.65 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-[1-(2-oxo-2-piperidin-1-ylethyl)benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-[1-(2-oxo-2-piperidin-1-ylethyl)benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16991194 |
| Molecular Formula | C29H38N4O5 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-[1-(2-oxo-2-piperidin-1-ylethyl)benzimidazol-2-yl]pentyl]benzamide |
| SMILES | COc1cc(C(=O)NCCCCCc2nc3ccccc3n2CC(=O)N2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C29H38N4O5/c1-36-24-18-21(19-25(37-2)28(24)38-3)29(35)30-15-9-4-6-14-26-31-22-12-7-8-13-23(22)33(26)20-27(34)32-16-10-5-11-17-32/h7-8,12-13,18-19H,4-6,9-11,14-17,20H2,1-3H3,(H,30,35) |
| InChIKey | ASNJQKXWQNYUEC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|