C28H31N3O5 — CID 17008602
3,4,5-trimethoxy-N-[[1-[3-(3-methylphenoxy)propyl]benzimidazol-2-yl]methyl]benzamide (PubChem CID 17008602) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[1-[3-(3-methylphenoxy)propyl]benzimidazol-2-yl]methyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[1-[3-(3-methylphenoxy)propyl]benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 17008602 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[1-[3-(3-methylphenoxy)propyl]benzimidazol-2-yl]methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2nc3ccccc3n2CCCOc2cccc(C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C28H31N3O5/c1-19-9-7-10-21(15-19)36-14-8-13-31-23-12-6-5-11-22(23)30-26(31)18-29-28(32)20-16-24(33-2)27(35-4)25(17-20)34-3/h5-7,9-12,15-17H,8,13-14,18H2,1-4H3,(H,29,32) |
| InChIKey | SJLMVPSUAHGACS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|