C29H33N3O6 — CID 17008633
3,4,5-trimethoxy-N-[[1-[4-(3-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide (PubChem CID 17008633) has the molecular formula C29H33N3O6 and a molecular weight of 519.60 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[1-[4-(3-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[1-[4-(3-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 17008633 |
| Molecular Formula | C29H33N3O6 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[1-[4-(3-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide |
| SMILES | COc1cccc(OCCCCn2c(CNC(=O)c3cc(OC)c(OC)c(OC)c3)nc3ccccc32)c1 |
| InChI | InChI=1S/C29H33N3O6/c1-34-21-10-9-11-22(18-21)38-15-8-7-14-32-24-13-6-5-12-23(24)31-27(32)19-30-29(33)20-16-25(35-2)28(37-4)26(17-20)36-3/h5-6,9-13,16-18H,7-8,14-15,19H2,1-4H3,(H,30,33) |
| InChIKey | HMGRIUOUIKNAIV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|