C26H35N3O2 — CID 170087045
2-[6-(dimethylamino)-9b-methyl-2-[3-(4-methylphenoxy)propyl]-1,3,4,4a-tetrahydropyrido[4,3-b]indol-5-yl]acetaldehyde (PubChem CID 170087045) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-[6-(dimethylamino)-9b-methyl-2-[3-(4-methylphenoxy)propyl]-1,3,4,4a-tetrahydropyrido[4,3-b]indol-5-yl]acetaldehyde.
| Compound Name | 2-[6-(dimethylamino)-9b-methyl-2-[3-(4-methylphenoxy)propyl]-1,3,4,4a-tetrahydropyrido[4,3-b]indol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 170087045 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 2-[6-(dimethylamino)-9b-methyl-2-[3-(4-methylphenoxy)propyl]-1,3,4,4a-tetrahydropyrido[4,3-b]indol-5-yl]acetaldehyde |
| SMILES | Cc1ccc(OCCCN2CCC3N(CC=O)c4c(N(C)C)cccc4C3(C)C2)cc1 |
| InChI | InChI=1S/C26H35N3O2/c1-20-9-11-21(12-10-20)31-18-6-14-28-15-13-24-26(2,19-28)22-7-5-8-23(27(3)4)25(22)29(24)16-17-30/h5,7-12,17,24H,6,13-16,18-19H2,1-4H3 |
| InChIKey | FZVOWUBZOCRFRN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|