C24H26FN3O2 — CID 178095474
5-fluoro-2-[3-[(10R)-10-methyl-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]propoxy]benzonitrile (PubChem CID 178095474) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is 5-fluoro-2-[3-[(10R)-10-methyl-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]propoxy]benzonitrile.
| Compound Name | 5-fluoro-2-[3-[(10R)-10-methyl-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 178095474 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 5-fluoro-2-[3-[(10R)-10-methyl-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]propoxy]benzonitrile |
| SMILES | C[C@@]12CN(CCCOc3ccc(F)cc3C#N)CCC1N1CCOc3cccc2c31 |
| InChI | InChI=1S/C24H26FN3O2/c1-24-16-27(9-3-12-29-20-7-6-18(25)14-17(20)15-26)10-8-22(24)28-11-13-30-21-5-2-4-19(24)23(21)28/h2,4-7,14,22H,3,8-13,16H2,1H3/t22?,24-/m0/s1 |
| InChIKey | CTXFEMNIUSSRAP-GITCGBDTSA-N |
| XLogP | 3.71 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|