C25H27FN4O2 — CID 178096196
2-[3-[(10R,15S)-2,4-dimethyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]propoxy]-5-fluorobenzonitrile (PubChem CID 178096196) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-[3-[(10R,15S)-2,4-dimethyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]propoxy]-5-fluorobenzonitrile.
| Compound Name | 2-[3-[(10R,15S)-2,4-dimethyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]propoxy]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 178096196 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[3-[(10R,15S)-2,4-dimethyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]propoxy]-5-fluorobenzonitrile |
| SMILES | CC1C(=O)N(C)c2cccc3c2N1[C@H]1CCN(CCCOc2ccc(F)cc2C#N)C[C@@H]31 |
| InChI | InChI=1S/C25H27FN4O2/c1-16-25(31)28(2)22-6-3-5-19-20-15-29(11-9-21(20)30(16)24(19)22)10-4-12-32-23-8-7-18(26)13-17(23)14-27/h3,5-8,13,16,20-21H,4,9-12,15H2,1-2H3/t16?,20-,21-/m0/s1 |
| InChIKey | WVVTWJZDCBUURY-ZMAUEPLISA-N |
| XLogP | 3.51 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|