C14H18N2O — CID 178095459
(10R,15S)-10-methyl-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 178095459) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (10R,15S)-10-methyl-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | (10R,15S)-10-methyl-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 178095459 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (10R,15S)-10-methyl-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | C[C@@]12CNCC[C@@H]1N1CCOc3cccc2c31 |
| InChI | InChI=1S/C14H18N2O/c1-14-9-15-6-5-12(14)16-7-8-17-11-4-2-3-10(14)13(11)16/h2-4,12,15H,5-9H2,1H3/t12-,14-/m0/s1 |
| InChIKey | JQKBGOJIALNWMG-JSGCOSHPSA-N |
| XLogP | 1.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |