C14H17N3O — CID 169190051
(10R)-10-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 169190051) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is (10R)-10-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | (10R)-10-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 169190051 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (10R)-10-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | C[C@@]12CNCCC1N1CC(=O)Nc3cccc2c31 |
| InChI | InChI=1S/C14H17N3O/c1-14-8-15-6-5-11(14)17-7-12(18)16-10-4-2-3-9(14)13(10)17/h2-4,11,15H,5-8H2,1H3,(H,16,18)/t11?,14-/m0/s1 |
| InChIKey | KXQDXLYDHVQSBD-IAXJKZSUSA-N |
| XLogP | 1.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |