C21H22F3NO2 — CID 170089604
2-[2-[[1-(2,6-difluoro-4-methylphenyl)piperidin-4-yl]methoxy]-5-fluorophenyl]acetaldehyde (PubChem CID 170089604) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 2-[2-[[1-(2,6-difluoro-4-methylphenyl)piperidin-4-yl]methoxy]-5-fluorophenyl]acetaldehyde.
| Compound Name | 2-[2-[[1-(2,6-difluoro-4-methylphenyl)piperidin-4-yl]methoxy]-5-fluorophenyl]acetaldehyde |
|---|---|
| PubChem CID | 170089604 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[2-[[1-(2,6-difluoro-4-methylphenyl)piperidin-4-yl]methoxy]-5-fluorophenyl]acetaldehyde |
| SMILES | Cc1cc(F)c(N2CCC(COc3ccc(F)cc3CC=O)CC2)c(F)c1 |
| InChI | InChI=1S/C21H22F3NO2/c1-14-10-18(23)21(19(24)11-14)25-7-4-15(5-8-25)13-27-20-3-2-17(22)12-16(20)6-9-26/h2-3,9-12,15H,4-8,13H2,1H3 |
| InChIKey | GIGBHCPQOXFXSI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|