C37H42N2 — CID 170096068
N-cyclohexa-2,4-dien-1-yl-N-(6-methylcyclohexen-1-yl)-4-[4-(3,4,5,6-tetrahydrocarbazol-9-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-amine (PubChem CID 170096068) has the molecular formula C37H42N2 and a molecular weight of 514.76 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-N-(6-methylcyclohexen-1-yl)-4-[4-(3,4,5,6-tetrahydrocarbazol-9-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-amine.
| Compound Name | N-cyclohexa-2,4-dien-1-yl-N-(6-methylcyclohexen-1-yl)-4-[4-(3,4,5,6-tetrahydrocarbazol-9-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 170096068 |
| Molecular Formula | C37H42N2 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-N-(6-methylcyclohexen-1-yl)-4-[4-(3,4,5,6-tetrahydrocarbazol-9-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-amine |
| SMILES | CC1CCCC=C1N(C1C=CC=CC1)C1C=CC(C2=CCC(n3c4c(c5c3C=CCC5)CCC=C4)C=C2)=CC1 |
| InChI | InChI=1S/C37H42N2/c1-27-11-5-8-16-35(27)38(30-12-3-2-4-13-30)31-23-19-28(20-24-31)29-21-25-32(26-22-29)39-36-17-9-6-14-33(36)34-15-7-10-18-37(34)39/h2-4,9-10,12,16-23,25,27,30-32H,5-8,11,13-15,24,26H2,1H3 |
| InChIKey | XCXUUEYRWGNPRJ-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |