C42H44N2 — CID 170020974
N-[4-[4-(1,2,4a,5,6,9a-hexahydrocarbazol-9-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-yl]-N-(4-phenylcyclohex-3-en-1-yl)aniline (PubChem CID 170020974) has the molecular formula C42H44N2 and a molecular weight of 576.83 g/mol. Its IUPAC name is N-[4-[4-(1,2,4a,5,6,9a-hexahydrocarbazol-9-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-yl]-N-(4-phenylcyclohex-3-en-1-yl)aniline.
| Compound Name | N-[4-[4-(1,2,4a,5,6,9a-hexahydrocarbazol-9-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-yl]-N-(4-phenylcyclohex-3-en-1-yl)aniline |
|---|---|
| PubChem CID | 170020974 |
| Molecular Formula | C42H44N2 |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | N-[4-[4-(1,2,4a,5,6,9a-hexahydrocarbazol-9-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-yl]-N-(4-phenylcyclohex-3-en-1-yl)aniline |
| SMILES | C1=CC2=C(CC1)C1C=CCCC1N2C1C=CC(C2=CCC(N(c3ccccc3)C3CC=C(c4ccccc4)CC3)C=C2)=CC1 |
| InChI | InChI=1S/C42H44N2/c1-3-11-31(12-4-1)32-19-25-36(26-20-32)43(35-13-5-2-6-14-35)37-27-21-33(22-28-37)34-23-29-38(30-24-34)44-41-17-9-7-15-39(41)40-16-8-10-18-42(40)44/h1-7,10-15,18-19,21-24,27,29,36-39,41H,8-9,16-17,20,25-26,28,30H2 |
| InChIKey | AWKYLJOOTDCFEC-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|