C33H28N4O2S2 — CID 170100153
4-[3-[3-(2-cyanothiophen-3-yl)-1-(4,4-dimethylpiperidin-1-yl)sulfanylindol-2-yl]phenyl]-N-oxobenzamide (PubChem CID 170100153) has the molecular formula C33H28N4O2S2 and a molecular weight of 576.75 g/mol. Its IUPAC name is 4-[3-[3-(2-cyanothiophen-3-yl)-1-(4,4-dimethylpiperidin-1-yl)sulfanylindol-2-yl]phenyl]-N-oxobenzamide.
| Compound Name | 4-[3-[3-(2-cyanothiophen-3-yl)-1-(4,4-dimethylpiperidin-1-yl)sulfanylindol-2-yl]phenyl]-N-oxobenzamide |
|---|---|
| PubChem CID | 170100153 |
| Molecular Formula | C33H28N4O2S2 |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 4-[3-[3-(2-cyanothiophen-3-yl)-1-(4,4-dimethylpiperidin-1-yl)sulfanylindol-2-yl]phenyl]-N-oxobenzamide |
| SMILES | CC1(C)CCN(Sn2c(-c3cccc(-c4ccc(C(=O)N=O)cc4)c3)c(-c3ccsc3C#N)c3ccccc32)CC1 |
| InChI | InChI=1S/C33H28N4O2S2/c1-33(2)15-17-36(18-16-33)41-37-28-9-4-3-8-26(28)30(27-14-19-40-29(27)21-34)31(37)25-7-5-6-24(20-25)22-10-12-23(13-11-22)32(38)35-39/h3-14,19-20H,15-18H2,1-2H3 |
| InChIKey | MMJURNLQGFVZRK-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 78.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|