C27H27FN4O2S — CID 170101583
tert-butyl 4-(8-fluoro-7-naphthalen-1-yl-2-sulfanylidene-1H-quinazolin-4-yl)piperazine-1-carboxylate (PubChem CID 170101583) has the molecular formula C27H27FN4O2S and a molecular weight of 490.60 g/mol. Its IUPAC name is tert-butyl 4-(8-fluoro-7-naphthalen-1-yl-2-sulfanylidene-1H-quinazolin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(8-fluoro-7-naphthalen-1-yl-2-sulfanylidene-1H-quinazolin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170101583 |
| Molecular Formula | C27H27FN4O2S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | tert-butyl 4-(8-fluoro-7-naphthalen-1-yl-2-sulfanylidene-1H-quinazolin-4-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nc(=S)[nH]c3c(F)c(-c4cccc5ccccc45)ccc23)CC1 |
| InChI | InChI=1S/C27H27FN4O2S/c1-27(2,3)34-26(33)32-15-13-31(14-16-32)24-21-12-11-20(22(28)23(21)29-25(35)30-24)19-10-6-8-17-7-4-5-9-18(17)19/h4-12H,13-16H2,1-3H3,(H,29,30,35) |
| InChIKey | ZMXHZABDJZLHDI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|