C15H27N2O2+ — CID 170102064
tert-butyl 2',3'-dimethylspiro[8-aza-3-azoniabicyclo[3.2.1]octane-3,1'-aziridin-1-ium]-8-carboxylate (PubChem CID 170102064) has the molecular formula C15H27N2O2+ and a molecular weight of 267.39 g/mol. Its IUPAC name is tert-butyl 2',3'-dimethylspiro[8-aza-3-azoniabicyclo[3.2.1]octane-3,1'-aziridin-1-ium]-8-carboxylate.
| Compound Name | tert-butyl 2',3'-dimethylspiro[8-aza-3-azoniabicyclo[3.2.1]octane-3,1'-aziridin-1-ium]-8-carboxylate |
|---|---|
| PubChem CID | 170102064 |
| Molecular Formula | C15H27N2O2+ |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | tert-butyl 2',3'-dimethylspiro[8-aza-3-azoniabicyclo[3.2.1]octane-3,1'-aziridin-1-ium]-8-carboxylate |
| SMILES | CC1C(C)[N+]12CC1CCC(C2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N2O2/c1-10-11(2)17(10)8-12-6-7-13(9-17)16(12)14(18)19-15(3,4)5/h10-13H,6-9H2,1-5H3/q+1 |
| InChIKey | DUMIDNRBTWIYQK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|