C21H28ClN5O3S — CID 170107680
tert-butyl 4-[4-[[3-chloro-5-(methylsulfanylamino)phenyl]carbamoyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 170107680) has the molecular formula C21H28ClN5O3S and a molecular weight of 466.01 g/mol. Its IUPAC name is tert-butyl 4-[4-[[3-chloro-5-(methylsulfanylamino)phenyl]carbamoyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[3-chloro-5-(methylsulfanylamino)phenyl]carbamoyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170107680 |
| Molecular Formula | C21H28ClN5O3S |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | tert-butyl 4-[4-[[3-chloro-5-(methylsulfanylamino)phenyl]carbamoyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CSNc1cc(Cl)cc(NC(=O)c2cnn(C3CCN(C(=O)OC(C)(C)C)CC3)c2)c1 |
| InChI | InChI=1S/C21H28ClN5O3S/c1-21(2,3)30-20(29)26-7-5-18(6-8-26)27-13-14(12-23-27)19(28)24-16-9-15(22)10-17(11-16)25-31-4/h9-13,18,25H,5-8H2,1-4H3,(H,24,28) |
| InChIKey | AGVLIBKXHKZMJG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|