C26H29N5O2 — CID 170110753
4-amino-N-ethyl-N-[3-[(3-prop-2-ynoxyphenyl)methylamino]cyclohex-3-en-1-yl]-1H-benzimidazole-2-carboxamide (PubChem CID 170110753) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-amino-N-ethyl-N-[3-[(3-prop-2-ynoxyphenyl)methylamino]cyclohex-3-en-1-yl]-1H-benzimidazole-2-carboxamide.
| Compound Name | 4-amino-N-ethyl-N-[3-[(3-prop-2-ynoxyphenyl)methylamino]cyclohex-3-en-1-yl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 170110753 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 4-amino-N-ethyl-N-[3-[(3-prop-2-ynoxyphenyl)methylamino]cyclohex-3-en-1-yl]-1H-benzimidazole-2-carboxamide |
| SMILES | C#CCOc1cccc(CNC2=CCCC(N(CC)C(=O)c3nc4c(N)cccc4[nH]3)C2)c1 |
| InChI | InChI=1S/C26H29N5O2/c1-3-14-33-21-11-5-8-18(15-21)17-28-19-9-6-10-20(16-19)31(4-2)26(32)25-29-23-13-7-12-22(27)24(23)30-25/h1,5,7-9,11-13,15,20,28H,4,6,10,14,16-17,27H2,2H3,(H,29,30) |
| InChIKey | VCSCZYJTOGPXCR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|