C26H29N7O2 — CID 135171103
6-azido-N-ethyl-N-[(1S,3R)-3-[(3-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide (PubChem CID 135171103) has the molecular formula C26H29N7O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is 6-azido-N-ethyl-N-[(1S,3R)-3-[(3-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide.
| Compound Name | 6-azido-N-ethyl-N-[(1S,3R)-3-[(3-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 135171103 |
| Molecular Formula | C26H29N7O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 6-azido-N-ethyl-N-[(1S,3R)-3-[(3-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide |
| SMILES | C#CCOc1cccc(CN[C@@H]2CCC[C@H](N(CC)C(=O)c3nc4ccc(N=[N+]=[N-])cc4[nH]3)C2)c1 |
| InChI | InChI=1S/C26H29N7O2/c1-3-13-35-22-10-5-7-18(14-22)17-28-19-8-6-9-21(15-19)33(4-2)26(34)25-29-23-12-11-20(31-32-27)16-24(23)30-25/h1,5,7,10-12,14,16,19,21,28H,4,6,8-9,13,15,17H2,2H3,(H,29,30)/t19-,21+/m1/s1 |
| InChIKey | AJHLVRXGIVINDK-CTNGQTDRSA-N |
| XLogP | 5.08 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|