C25H31N5O — CID 170113162
N-ethyl-N-[(1S,3R)-3-[[4-(methyldiazenyl)phenyl]methylamino]cyclohexyl]-1H-indole-2-carboxamide (PubChem CID 170113162) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is N-ethyl-N-[(1S,3R)-3-[[4-(methyldiazenyl)phenyl]methylamino]cyclohexyl]-1H-indole-2-carboxamide.
| Compound Name | N-ethyl-N-[(1S,3R)-3-[[4-(methyldiazenyl)phenyl]methylamino]cyclohexyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 170113162 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | N-ethyl-N-[(1S,3R)-3-[[4-(methyldiazenyl)phenyl]methylamino]cyclohexyl]-1H-indole-2-carboxamide |
| SMILES | CCN(C(=O)c1cc2ccccc2[nH]1)[C@H]1CCC[C@@H](NCc2ccc(/N=N/C)cc2)C1 |
| InChI | InChI=1S/C25H31N5O/c1-3-30(25(31)24-15-19-7-4-5-10-23(19)28-24)22-9-6-8-21(16-22)27-17-18-11-13-20(14-12-18)29-26-2/h4-5,7,10-15,21-22,27-28H,3,6,8-9,16-17H2,1-2H3/b29-26+/t21-,22+/m1/s1 |
| InChIKey | WJRWUYSTOXDFRJ-IZMBKAGZSA-N |
| XLogP | 5.44 |
| TPSA | 72.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|