C22H31N3O3 — CID 135170778
tert-butyl N-[(1R,3S)-3-[ethyl(1H-indole-2-carbonyl)amino]cyclohexyl]carbamate (PubChem CID 135170778) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-[ethyl(1H-indole-2-carbonyl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-[ethyl(1H-indole-2-carbonyl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 135170778 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-[ethyl(1H-indole-2-carbonyl)amino]cyclohexyl]carbamate |
| SMILES | CCN(C(=O)c1cc2ccccc2[nH]1)[C@H]1CCC[C@@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H31N3O3/c1-5-25(20(26)19-13-15-9-6-7-12-18(15)24-19)17-11-8-10-16(14-17)23-21(27)28-22(2,3)4/h6-7,9,12-13,16-17,24H,5,8,10-11,14H2,1-4H3,(H,23,27)/t16-,17+/m1/s1 |
| InChIKey | TXSYTTIERRGPLJ-SJORKVTESA-N |
| XLogP | 4.47 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |