C49H60N6O2 — CID 161347630
N-[(3R)-3-(benzylamino)cyclohexyl]-N-ethyl-1H-indole-2-carboxamide;N-[(3R)-3-[benzyl(methyl)amino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide (PubChem CID 161347630) has the molecular formula C49H60N6O2 and a molecular weight of 765.06 g/mol. Its IUPAC name is N-[(3R)-3-(benzylamino)cyclohexyl]-N-ethyl-1H-indole-2-carboxamide;N-[(3R)-3-[benzyl(methyl)amino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | N-[(3R)-3-(benzylamino)cyclohexyl]-N-ethyl-1H-indole-2-carboxamide;N-[(3R)-3-[benzyl(methyl)amino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 161347630 |
| Molecular Formula | C49H60N6O2 |
| Molecular Weight | 765.06 g/mol |
| Exact Mass | 764.48 |
| IUPAC Name | N-[(3R)-3-(benzylamino)cyclohexyl]-N-ethyl-1H-indole-2-carboxamide;N-[(3R)-3-[benzyl(methyl)amino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide |
| SMILES | CCN(C(=O)c1cc2ccccc2[nH]1)C1CCC[C@@H](N(C)Cc2ccccc2)C1.CCN(C(=O)c1cc2ccccc2[nH]1)C1CCC[C@@H](NCc2ccccc2)C1 |
| InChI | InChI=1S/C25H31N3O.C24H29N3O/c1-3-28(25(29)24-16-20-12-7-8-15-23(20)26-24)22-14-9-13-21(17-22)27(2)18-19-10-5-4-6-11-19;1-2-27(24(28)23-15-19-11-6-7-14-22(19)26-23)21-13-8-12-20(16-21)25-17-18-9-4-3-5-10-18/h4-8,10-12,15-16,21-22,26H,3,9,13-14,17-18H2,1-2H3;3-7,9-11,14-15,20-21,25-26H,2,8,12-13,16-17H2,1H3/t21-,22?;20-,21?/m11/s1 |
| InChIKey | VNNAOETVPMKPOS-WTOOQMGASA-N |
| XLogP | 9.80 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.06 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |