C33H33N3O2 — CID 135156924
N-ethyl-N-[(1S,3R)-3-[[3-(4-ethynylbenzoyl)phenyl]methylamino]cyclohexyl]-1H-indole-2-carboxamide (PubChem CID 135156924) has the molecular formula C33H33N3O2 and a molecular weight of 503.65 g/mol. Its IUPAC name is N-ethyl-N-[(1S,3R)-3-[[3-(4-ethynylbenzoyl)phenyl]methylamino]cyclohexyl]-1H-indole-2-carboxamide.
| Compound Name | N-ethyl-N-[(1S,3R)-3-[[3-(4-ethynylbenzoyl)phenyl]methylamino]cyclohexyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135156924 |
| Molecular Formula | C33H33N3O2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | N-ethyl-N-[(1S,3R)-3-[[3-(4-ethynylbenzoyl)phenyl]methylamino]cyclohexyl]-1H-indole-2-carboxamide |
| SMILES | C#Cc1ccc(C(=O)c2cccc(CN[C@@H]3CCC[C@H](N(CC)C(=O)c4cc5ccccc5[nH]4)C3)c2)cc1 |
| InChI | InChI=1S/C33H33N3O2/c1-3-23-15-17-25(18-16-23)32(37)27-11-7-9-24(19-27)22-34-28-12-8-13-29(21-28)36(4-2)33(38)31-20-26-10-5-6-14-30(26)35-31/h1,5-7,9-11,14-20,28-29,34-35H,4,8,12-13,21-22H2,2H3/t28-,29+/m1/s1 |
| InChIKey | ARIQCIDTPLDNBE-WDYNHAJCSA-N |
| XLogP | 5.94 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|