C31H39N5O2 — CID 155076800
N-[(1S,3R)-3-[[4-[2-(3-but-3-ynyldiaziridin-3-yl)ethoxy]phenyl]methylamino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide (PubChem CID 155076800) has the molecular formula C31H39N5O2 and a molecular weight of 513.69 g/mol. Its IUPAC name is N-[(1S,3R)-3-[[4-[2-(3-but-3-ynyldiaziridin-3-yl)ethoxy]phenyl]methylamino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1S,3R)-3-[[4-[2-(3-but-3-ynyldiaziridin-3-yl)ethoxy]phenyl]methylamino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 155076800 |
| Molecular Formula | C31H39N5O2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | N-[(1S,3R)-3-[[4-[2-(3-but-3-ynyldiaziridin-3-yl)ethoxy]phenyl]methylamino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide |
| SMILES | C#CCCC1(CCOc2ccc(CN[C@@H]3CCC[C@H](N(CC)C(=O)c4cc5ccccc5[nH]4)C3)cc2)NN1 |
| InChI | InChI=1S/C31H39N5O2/c1-3-5-17-31(34-35-31)18-19-38-27-15-13-23(14-16-27)22-32-25-10-8-11-26(21-25)36(4-2)30(37)29-20-24-9-6-7-12-28(24)33-29/h1,6-7,9,12-16,20,25-26,32-35H,4-5,8,10-11,17-19,21-22H2,2H3/t25-,26+/m1/s1 |
| InChIKey | XRCRHWCXARYOQA-FTJBHMTQSA-N |
| XLogP | 4.72 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|