C25H32N4O — CID 135171020
N-[(1S,3R)-3-[(4-amino-3-methylphenyl)methylamino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide (PubChem CID 135171020) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is N-[(1S,3R)-3-[(4-amino-3-methylphenyl)methylamino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1S,3R)-3-[(4-amino-3-methylphenyl)methylamino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135171020 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | N-[(1S,3R)-3-[(4-amino-3-methylphenyl)methylamino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide |
| SMILES | CCN(C(=O)c1cc2ccccc2[nH]1)[C@H]1CCC[C@@H](NCc2ccc(N)c(C)c2)C1 |
| InChI | InChI=1S/C25H32N4O/c1-3-29(25(30)24-14-19-7-4-5-10-23(19)28-24)21-9-6-8-20(15-21)27-16-18-11-12-22(26)17(2)13-18/h4-5,7,10-14,20-21,27-28H,3,6,8-9,15-16,26H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | QZSRZRUBIIYINM-RTWAWAEBSA-N |
| XLogP | 4.62 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|