C25H31N3O — CID 135171015
N-[3-[benzyl(methyl)amino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide (PubChem CID 135171015) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)amino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135171015 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]cyclohexyl]-N-ethyl-1H-indole-2-carboxamide |
| SMILES | CCN(C(=O)c1cc2ccccc2[nH]1)C1CCCC(N(C)Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H31N3O/c1-3-28(25(29)24-16-20-12-7-8-15-23(20)26-24)22-14-9-13-21(17-22)27(2)18-19-10-5-4-6-11-19/h4-8,10-12,15-16,21-22,26H,3,9,13-14,17-18H2,1-2H3 |
| InChIKey | AUGQCNVIHZRCER-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |