C24H29N3OS — CID 170108839
N-[(1S)-3-(benzylamino)-3-sulfanylcyclohexyl]-N-ethyl-1H-indole-2-carboxamide (PubChem CID 170108839) has the molecular formula C24H29N3OS and a molecular weight of 407.58 g/mol. Its IUPAC name is N-[(1S)-3-(benzylamino)-3-sulfanylcyclohexyl]-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1S)-3-(benzylamino)-3-sulfanylcyclohexyl]-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 170108839 |
| Molecular Formula | C24H29N3OS |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[(1S)-3-(benzylamino)-3-sulfanylcyclohexyl]-N-ethyl-1H-indole-2-carboxamide |
| SMILES | CCN(C(=O)c1cc2ccccc2[nH]1)[C@H]1CCCC(S)(NCc2ccccc2)C1 |
| InChI | InChI=1S/C24H29N3OS/c1-2-27(23(28)22-15-19-11-6-7-13-21(19)26-22)20-12-8-14-24(29,16-20)25-17-18-9-4-3-5-10-18/h3-7,9-11,13,15,20,25-26,29H,2,8,12,14,16-17H2,1H3/t20-,24?/m0/s1 |
| InChIKey | ZWBPTDZWYXKOTG-QHELBMECSA-N |
| XLogP | 4.99 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|