C25H28N4O2S — CID 170109158
N-[(1S)-3-(1-benzofuran-2-ylmethylamino)-3-sulfanylcyclohexyl]-N-ethyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide (PubChem CID 170109158) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[(1S)-3-(1-benzofuran-2-ylmethylamino)-3-sulfanylcyclohexyl]-N-ethyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide.
| Compound Name | N-[(1S)-3-(1-benzofuran-2-ylmethylamino)-3-sulfanylcyclohexyl]-N-ethyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170109158 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-[(1S)-3-(1-benzofuran-2-ylmethylamino)-3-sulfanylcyclohexyl]-N-ethyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide |
| SMILES | CCN(C(=O)c1cc2ncccc2[nH]1)[C@H]1CCCC(S)(NCc2cc3ccccc3o2)C1 |
| InChI | InChI=1S/C25H28N4O2S/c1-2-29(24(30)22-14-21-20(28-22)9-6-12-26-21)18-8-5-11-25(32,15-18)27-16-19-13-17-7-3-4-10-23(17)31-19/h3-4,6-7,9-10,12-14,18,27-28,32H,2,5,8,11,15-16H2,1H3/t18-,25?/m0/s1 |
| InChIKey | GRDOIQBCFHHKFM-CPFIQGLUSA-N |
| XLogP | 5.13 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|